Sodium 3-octylbenzene sulfonate
Modify Date: 2026-07-08 11:14:30
Sodium 3-octylbenzene sulfonate structure
|
Common Name | Sodium 3-octylbenzene sulfonate | ||
|---|---|---|---|---|
| CAS Number | 112714-98-4 | Molecular Weight | 292.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H21NaO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Sodium 3-octylbenzene sulfonate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H21NaO3S |
|---|---|
| Molecular Weight | 292.37 |
| InChIKey | WJHWYLGTYGBGBC-UHFFFAOYSA-M |
| SMILES | CCCCCCCCc1cccc(S(=O)(=O)[O-])c1.[Na+] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Sodium 3-octylbenzene sulfonate? |
| A: InChIKey of Sodium 3-octylbenzene sulfonate is WJHWYLGTYGBGBC-UHFFFAOYSA-M. |
| Q: What is the Chinese name of 112714-98-4? |
| A: Chinese name of 112714-98-4 is 112714-98-4. |
| Q: What is the English name of Sodium 3-octylbenzene sulfonate? |
| A: The English name of Sodium 3-octylbenzene sulfonate is Sodium 3-octylbenzene sulfonate. |
| Q: What is the molecular weight of Sodium 3-octylbenzene sulfonate? |
| A: Molecular weight of Sodium 3-octylbenzene sulfonate is 292.37. |
| Q: What is the molecular formula of Sodium 3-octylbenzene sulfonate? |
| A: Molecular formula of Sodium 3-octylbenzene sulfonate is C14H21NaO3S. |
| Q: What is the CAS number of Sodium 3-octylbenzene sulfonate? |
| A: CAS number of Sodium 3-octylbenzene sulfonate is 112714-98-4. |
| Q: What is the SMILES notation of Sodium 3-octylbenzene sulfonate? |
| A: SMILES notation of Sodium 3-octylbenzene sulfonate is CCCCCCCCc1cccc(S(=O)(=O)[O-])c1.[Na+]. |