3-(4-hydroxyphenyl)-2-(2-phenylethenyl)quinazolin-4-one structure
|
Common Name | 3-(4-hydroxyphenyl)-2-(2-phenylethenyl)quinazolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 112750-80-8 | Molecular Weight | 340.37500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(4-hydroxyphenyl)-2-(2-phenylethenyl)quinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H16N2O2 |
|---|---|
| Molecular Weight | 340.37500 |
| Exact Mass | 340.12100 |
| PSA | 55.12000 |
| LogP | 4.26170 |
| InChIKey | UODHAIKICSVODS-UHFFFAOYSA-N |
| SMILES | O=c1c2ccccc2nc(C=Cc2ccccc2)n1-c1ccc(O)cc1 |
|
~60%
3-(4-hydroxyphe... CAS#:112750-80-8 |
| Literature: Pandey; Kumar, Jitendra; Saxena; Mukesh; Joshi; Bajpai Journal of the Indian Chemical Society, 2007 , vol. 84, # 6 p. 593 - 597 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4(3H)-Quinazolinone,3-(4-hydroxyphenyl)-2-(2-phenylethenyl) |
| 2-styryl-3-(4-hydroxyphenyl)-4-oxo(3H)-quinazoline |