[1-[2-[(2,2,2-trifluoroacetyl)amino]phenyl]pyrrol-2-yl] thiocyanate structure
|
Common Name | [1-[2-[(2,2,2-trifluoroacetyl)amino]phenyl]pyrrol-2-yl] thiocyanate | ||
|---|---|---|---|---|
| CAS Number | 112798-15-9 | Molecular Weight | 311.28200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8F3N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [1-[2-[(2,2,2-trifluoroacetyl)amino]phenyl]pyrrol-2-yl] thiocyanate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H8F3N3OS |
|---|---|
| Molecular Weight | 311.28200 |
| Exact Mass | 311.03400 |
| PSA | 86.61000 |
| LogP | 4.20078 |
| InChIKey | DIGVOIDGYREHAF-UHFFFAOYSA-N |
| SMILES | N#CSc1cccn1-c1ccccc1NC(=O)C(F)(F)F |
|
~66%
[1-[2-[(2,2,2-t... CAS#:112798-15-9 |
| Literature: Cheeseman, G. W. H.; Varvounis, G. Journal of Heterocyclic Chemistry, 1987 , vol. 24, p. 1157 - 1161 |
|
~%
[1-[2-[(2,2,2-t... CAS#:112798-15-9 |
| Literature: Cheeseman, G. W. H.; Varvounis, G. Journal of Heterocyclic Chemistry, 1987 , vol. 24, p. 1157 - 1161 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-(2-Trifluoroacetamidophenyl)-2-thiocyanatopyrrole |
| Thiocyanic acid,1-[2-[(trifluoroacetyl)amino]phenyl]-1H-pyrrol-2-yl ester |
| 1-(2-trifluoroacetylaminophenyl)-2-thiocyanatopyrrole |