4-Amino-5-chloro-2-ethoxy-N-((4-(2-fluorobenzyl)morpholin-2-yl)methyl)benzamide structure
|
Common Name | 4-Amino-5-chloro-2-ethoxy-N-((4-(2-fluorobenzyl)morpholin-2-yl)methyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 112886-58-5 | Molecular Weight | 421.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H25ClFN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-Amino-5-chloro-2-ethoxy-N-((4-(2-fluorobenzyl)morpholin-2-yl)methyl)benzamide |
|---|
| Molecular Formula | C21H25ClFN3O3 |
|---|---|
| Molecular Weight | 421.9 |
| InChIKey | AMJFKMSORSOSOB-UHFFFAOYSA-N |
| SMILES | CCOc1cc(N)c(Cl)cc1C(=O)NCC1CN(Cc2ccccc2F)CCO1 |
|
Name: Gastric emptying of phenol red semisolid meal in rats at dose of 2.0 mg/kg, administe...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL781907
|