2,6-bis(bromomethyl)-4-octylphenol structure
|
Common Name | 2,6-bis(bromomethyl)-4-octylphenol | ||
|---|---|---|---|---|
| CAS Number | 112921-43-4 | Molecular Weight | 392.16900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H24Br2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-bis(bromomethyl)-4-octylphenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H24Br2O |
|---|---|
| Molecular Weight | 392.16900 |
| Exact Mass | 390.01900 |
| PSA | 20.23000 |
| LogP | 6.08500 |
| InChIKey | ZNHTZJYZXLSQRG-UHFFFAOYSA-N |
| SMILES | CCCCCCCCc1cc(CBr)c(O)c(CBr)c1 |
|
~64%
2,6-bis(bromome... CAS#:112921-43-4 |
| Literature: Tetrahedron, , vol. 47, # 10/11 p. 1911 - 1924 |
|
~71%
2,6-bis(bromome... CAS#:112921-43-4 |
| Literature: Journal of Crystallographic and Spectroscopic Research, , vol. 21, # 1 p. 69 - 74 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,6-Bis(bromomethyl)-p-octylphenol |
| 2,6-bisbromomethyl-4-octylphenol |
| Phenol,2,6-bis(bromomethyl)-4-octyl |