11-Deoxy-20-hydroxy methylprednisolone
Modify Date: 2025-11-13 17:30:59
11-Deoxy-20-hydroxy methylprednisolone structure
|
Common Name | 11-Deoxy-20-hydroxy methylprednisolone | ||
|---|---|---|---|---|
| CAS Number | 112925-32-3 | Molecular Weight | 360.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H32O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 11-Deoxy-20-hydroxy methylprednisolone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H32O4 |
|---|---|
| Molecular Weight | 360.5 |
| InChIKey | WVRNWTZUTREBFN-IXDJXPLESA-N |
| SMILES | CC1CC2C(CCC3(C)C2CCC3(O)C(O)CO)C2(C)C=CC(=O)C=C12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 11-Deoxy-20-hydroxy methylprednisolone? |
| A: InChIKey of 11-Deoxy-20-hydroxy methylprednisolone is WVRNWTZUTREBFN-IXDJXPLESA-N. |
| Q: What is the Chinese name of 112925-32-3? |
| A: Chinese name of 112925-32-3 is 112925-32-3. |
| Q: What is the CAS number of 11-Deoxy-20-hydroxy methylprednisolone? |
| A: CAS number of 11-Deoxy-20-hydroxy methylprednisolone is 112925-32-3. |
| Q: What is the molecular weight of 11-Deoxy-20-hydroxy methylprednisolone? |
| A: Molecular weight of 11-Deoxy-20-hydroxy methylprednisolone is 360.5. |
| Q: What is the SMILES notation of 11-Deoxy-20-hydroxy methylprednisolone? |
| A: SMILES notation of 11-Deoxy-20-hydroxy methylprednisolone is CC1CC2C(CCC3(C)C2CCC3(O)C(O)CO)C2(C)C=CC(=O)C=C12. |
| Q: What is the molecular formula of 11-Deoxy-20-hydroxy methylprednisolone? |
| A: Molecular formula of 11-Deoxy-20-hydroxy methylprednisolone is C22H32O4. |
| Q: What is the English name of 11-Deoxy-20-hydroxy methylprednisolone? |
| A: The English name of 11-Deoxy-20-hydroxy methylprednisolone is 11-Deoxy-20-hydroxy methylprednisolone. |