2-[5-chloro-3-(2-methylphenyl)-4-oxochromen-7-yl]oxyacetic acid structure
|
Common Name | 2-[5-chloro-3-(2-methylphenyl)-4-oxochromen-7-yl]oxyacetic acid | ||
|---|---|---|---|---|
| CAS Number | 112953-47-6 | Molecular Weight | 344.74600 | |
| Density | 1.42g/cm3 | Boiling Point | 568.3ºC at 760mmHg | |
| Molecular Formula | C18H13ClO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 297.5ºC | |
| Name | 2-[5-chloro-3-(2-methylphenyl)-4-oxochromen-7-yl]oxyacetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 568.3ºC at 760mmHg |
| Molecular Formula | C18H13ClO5 |
| Molecular Weight | 344.74600 |
| Flash Point | 297.5ºC |
| Exact Mass | 344.04500 |
| PSA | 76.74000 |
| LogP | 3.88520 |
| Vapour Pressure | 9.44E-14mmHg at 25°C |
| Index of Refraction | 1.634 |
| InChIKey | POJPNUILSOANLV-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1-c1coc2cc(OCC(=O)O)cc(Cl)c2c1=O |
|
~85%
2-[5-chloro-3-(... CAS#:112953-47-6 |
| Literature: Kitagawa; Yamamoto; Katakura; Kanno; Yamada; Nagahara; Tanaka Chemical and Pharmaceutical Bulletin, 1991 , vol. 39, # 10 p. 2681 - 2690 |
|
~%
2-[5-chloro-3-(... CAS#:112953-47-6 |
| Literature: Kitagawa; Yamamoto; Katakura; Kanno; Yamada; Nagahara; Tanaka Chemical and Pharmaceutical Bulletin, 1991 , vol. 39, # 10 p. 2681 - 2690 |
|
~%
2-[5-chloro-3-(... CAS#:112953-47-6 |
| Literature: Kitagawa; Yamamoto; Katakura; Kanno; Yamada; Nagahara; Tanaka Chemical and Pharmaceutical Bulletin, 1991 , vol. 39, # 10 p. 2681 - 2690 |
|
~%
2-[5-chloro-3-(... CAS#:112953-47-6 |
| Literature: Kitagawa; Yamamoto; Katakura; Kanno; Yamada; Nagahara; Tanaka Chemical and Pharmaceutical Bulletin, 1991 , vol. 39, # 10 p. 2681 - 2690 |
|
~%
2-[5-chloro-3-(... CAS#:112953-47-6 |
| Literature: Kitagawa; Yamamoto; Katakura; Kanno; Yamada; Nagahara; Tanaka Chemical and Pharmaceutical Bulletin, 1991 , vol. 39, # 10 p. 2681 - 2690 |
| Acetic acid,((5-chloro-3-(2-methylphenyl)-4-oxo-4H-1-benzopyran-7-yl)oxy) |
| {[5-chloro-3-(2-methylphenyl)-4-oxo-4H-chromen-7-yl]oxy}acetic acid |
| ((5-Chloro-3-(2-methylphenol)-4-oxo-4H-1-benzopyran-7-yl)oxy)acetic acid |
| {[5-chloro-3-(2-methylphenyl)-4-oxo-4H-1-benzopyran-7-yl]oxy}acetic acid |
| DR-3438 |