2-oxo-delta(3)-4,5,5-trimethylcyclopentenylacetic acid structure
|
Common Name | 2-oxo-delta(3)-4,5,5-trimethylcyclopentenylacetic acid | ||
|---|---|---|---|---|
| CAS Number | 1130-49-0 | Molecular Weight | 182.21600 | |
| Density | 1.09g/cm3 | Boiling Point | 328.2ºC at 760mmHg | |
| Molecular Formula | C10H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.5ºC | |
| Name | (2,2,3-trimethyl-5-oxocyclopent-3-en-1-yl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 328.2ºC at 760mmHg |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.21600 |
| Flash Point | 166.5ºC |
| Exact Mass | 182.09400 |
| PSA | 54.37000 |
| LogP | 1.63250 |
| Vapour Pressure | 3.82E-05mmHg at 25°C |
| Index of Refraction | 1.482 |
| InChIKey | UJJNLVMCZZZXFW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C(CC(=O)O)C1(C)C |
| HS Code | 2918300090 |
|---|
|
~%
2-oxo-delta(3)-... CAS#:1130-49-0 |
| Literature: Bredt; Pinten Journal fuer Praktische Chemie (Leipzig), 1928 , vol. <2> 119, p. 86,101 |
|
~%
2-oxo-delta(3)-... CAS#:1130-49-0 |
| Literature: AROMAGEN CORPORATION Patent: WO2004/13079 A1, 2004 ; Location in patent: Page 20-21 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| (2,2,3-Trimethyl-5-oxo-cyclopent-3-enyl)-essigsaeure |
| ketocampholenic acid |
| 2-Oxo-delta3-4,5,5-trimethylcyclopentenylacetic acid |
| Otmcpa |
| (2,2,3-trimethyl-5-oxo-cyclopent-3-enyl)-acetic acid |
| 2-oxo-4,5,5-trimethylcyclopent-3-enylacetic acid,KCA |
| 1.1.2-Trimethyl-cyclopenten-(2)-on-(4)-essigsaeure-(5) |