rel-(3aR,6S,6aS)-6-Ethoxy-6,6a-dihydro-3-phenylfuro[3,4-d]isoxazol-4(3aH)-one
Modify Date: 2026-09-23 08:13:20
![rel-(3aR,6S,6aS)-6-Ethoxy-6,6a-dihydro-3-phenylfuro[3,4-d]isoxazol-4(3aH)-one Structure](https://www.chemsrc.com/extcaspic/105/113003-50-2.png)
rel-(3aR,6S,6aS)-6-Ethoxy-6,6a-dihydro-3-phenylfuro[3,4-d]isoxazol-4(3aH)-one structure
|
Common Name | rel-(3aR,6S,6aS)-6-Ethoxy-6,6a-dihydro-3-phenylfuro[3,4-d]isoxazol-4(3aH)-one | ||
|---|---|---|---|---|
| CAS Number | 113003-50-2 | Molecular Weight | 247.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | rel-(3aR,6S,6aS)-6-Ethoxy-6,6a-dihydro-3-phenylfuro[3,4-d]isoxazol-4(3aH)-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H13NO4 |
|---|---|
| Molecular Weight | 247.25 |
| InChIKey | AUDXMGHAXRCOSO-CDMKHQONSA-N |
| SMILES | CCOC1OC(=O)C2C(c3ccccc3)=NOC12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of rel-(3aR,6S,6aS)-6-Ethoxy-6,6a-dihydro-3-phenylfuro[3,4-d]isoxazol-4(3aH)-one? |
| A: SMILES notation of rel-(3aR,6S,6aS)-6-Ethoxy-6,6a-dihydro-3-phenylfuro[3,4-d]isoxazol-4(3aH)-one is CCOC1OC(=O)C2C(c3ccccc3)=NOC12. |
| Q: What is the InChIKey of rel-(3aR,6S,6aS)-6-Ethoxy-6,6a-dihydro-3-phenylfuro[3,4-d]isoxazol-4(3aH)-one? |
| A: InChIKey of rel-(3aR,6S,6aS)-6-Ethoxy-6,6a-dihydro-3-phenylfuro[3,4-d]isoxazol-4(3aH)-one is AUDXMGHAXRCOSO-CDMKHQONSA-N. |
| Q: What is the molecular weight of rel-(3aR,6S,6aS)-6-Ethoxy-6,6a-dihydro-3-phenylfuro[3,4-d]isoxazol-4(3aH)-one? |
| A: Molecular weight of rel-(3aR,6S,6aS)-6-Ethoxy-6,6a-dihydro-3-phenylfuro[3,4-d]isoxazol-4(3aH)-one is 247.25. |
| Q: What is the CAS number of rel-(3aR,6S,6aS)-6-Ethoxy-6,6a-dihydro-3-phenylfuro[3,4-d]isoxazol-4(3aH)-one? |
| A: CAS number of rel-(3aR,6S,6aS)-6-Ethoxy-6,6a-dihydro-3-phenylfuro[3,4-d]isoxazol-4(3aH)-one is 113003-50-2. |
| Q: What is the Chinese name of 113003-50-2? |
| A: Chinese name of 113003-50-2 is 113003-50-2. |
| Q: What is the molecular formula of rel-(3aR,6S,6aS)-6-Ethoxy-6,6a-dihydro-3-phenylfuro[3,4-d]isoxazol-4(3aH)-one? |
| A: Molecular formula of rel-(3aR,6S,6aS)-6-Ethoxy-6,6a-dihydro-3-phenylfuro[3,4-d]isoxazol-4(3aH)-one is C13H13NO4. |
| Q: What is the English name of rel-(3aR,6S,6aS)-6-Ethoxy-6,6a-dihydro-3-phenylfuro[3,4-d]isoxazol-4(3aH)-one? |
| A: The English name of rel-(3aR,6S,6aS)-6-Ethoxy-6,6a-dihydro-3-phenylfuro[3,4-d]isoxazol-4(3aH)-one is rel-(3aR,6S,6aS)-6-Ethoxy-6,6a-dihydro-3-phenylfuro[3,4-d]isoxazol-4(3aH)-one. |