Donafenib (Sorafenib D3) structure
|
Common Name | Donafenib (Sorafenib D3) | ||
|---|---|---|---|---|
| CAS Number | 1130115-44-4 | Molecular Weight | 467.84300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H13ClD3F3N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Donafenib (Sorafenib D3)Sorafenib D3 (Bay 43-9006 D3) is the deuterium labeled Sorafenib. Sorafenib is a multikinase inhibitor IC50s of 6 nM, 20 nM, and 22 nM for Raf-1, B-Raf, and VEGFR-3, respectively. |
| Name | 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-(trideuteriomethyl)pyridine-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Description | Sorafenib D3 (Bay 43-9006 D3) is the deuterium labeled Sorafenib. Sorafenib is a multikinase inhibitor IC50s of 6 nM, 20 nM, and 22 nM for Raf-1, B-Raf, and VEGFR-3, respectively. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C21H13ClD3F3N4O3 |
|---|---|
| Molecular Weight | 467.84300 |
| Exact Mass | 467.10500 |
| PSA | 92.35000 |
| LogP | 6.08660 |
| InChIKey | MLDQJTXFUGDVEO-FIBGUPNXSA-N |
| SMILES | CNC(=O)c1cc(Oc2ccc(NC(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)cc2)ccn1 |
| Hazard Codes | Xi |
|---|
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| 4-(4-(3-(4-chloro-3-(trifluoromethyl)phenyl)ureido)-phenyoxy)-N-(methyl-d3)picolinamide |
| Sorafenib-d3 |
| 4-[4-[[[[4-Chloro-3-(trifluoromethyl)phenyl]amino]carbonyl]amino]phenoxy]-N-(methyl-d3)-2-pyridinecarboxamide |
| BAY-43-9006-d3 |
| Sorafenib D3 |
| SIMVASTATIN 4'-METHYL ETHER |
| Sorafenib-methyl-d3 |
| 4-(4-(3-(4-chloro-3-(trifluoromethyl)phenyl)ureido)-phenoxy)-N-(methyl-d3)picolinamide |
| N-(4-chloro-3-(trifluoromethyl)phenyl)-N'-(4-(2-(N-(methyl-d3)aminoformyl)-4-pyridyloxy)phenyl)urea |