3-Methoxy-2-phenyl-6-(propylthio)imidazo[1,2-b]pyridazine
Modify Date: 2025-11-06 16:54:36
![3-Methoxy-2-phenyl-6-(propylthio)imidazo[1,2-b]pyridazine Structure](https://www.chemsrc.com/extcaspic/145/113121-37-2.png)
3-Methoxy-2-phenyl-6-(propylthio)imidazo[1,2-b]pyridazine structure
|
Common Name | 3-Methoxy-2-phenyl-6-(propylthio)imidazo[1,2-b]pyridazine | ||
|---|---|---|---|---|
| CAS Number | 113121-37-2 | Molecular Weight | 299.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Methoxy-2-phenyl-6-(propylthio)imidazo[1,2-b]pyridazine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H17N3OS |
|---|---|
| Molecular Weight | 299.4 |
| InChIKey | LNTTZFJCFQJRRN-UHFFFAOYSA-N |
| SMILES | CCCSc1ccc2nc(-c3ccccc3)c(OC)n2n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 3-Methoxy-2-phenyl-6-(propylthio)imidazo[1,2-b]pyridazine? |
| A: Molecular weight of 3-Methoxy-2-phenyl-6-(propylthio)imidazo[1,2-b]pyridazine is 299.4. |
| Q: What is the CAS number of 3-Methoxy-2-phenyl-6-(propylthio)imidazo[1,2-b]pyridazine? |
| A: CAS number of 3-Methoxy-2-phenyl-6-(propylthio)imidazo[1,2-b]pyridazine is 113121-37-2. |
| Q: What is the English name of 3-Methoxy-2-phenyl-6-(propylthio)imidazo[1,2-b]pyridazine? |
| A: The English name of 3-Methoxy-2-phenyl-6-(propylthio)imidazo[1,2-b]pyridazine is 3-Methoxy-2-phenyl-6-(propylthio)imidazo[1,2-b]pyridazine. |
| Q: What is the Chinese name of 113121-37-2? |
| A: Chinese name of 113121-37-2 is 113121-37-2. |
| Q: What is the SMILES notation of 3-Methoxy-2-phenyl-6-(propylthio)imidazo[1,2-b]pyridazine? |
| A: SMILES notation of 3-Methoxy-2-phenyl-6-(propylthio)imidazo[1,2-b]pyridazine is CCCSc1ccc2nc(-c3ccccc3)c(OC)n2n1. |
| Q: What is the molecular formula of 3-Methoxy-2-phenyl-6-(propylthio)imidazo[1,2-b]pyridazine? |
| A: Molecular formula of 3-Methoxy-2-phenyl-6-(propylthio)imidazo[1,2-b]pyridazine is C16H17N3OS. |
| Q: What is the InChIKey of 3-Methoxy-2-phenyl-6-(propylthio)imidazo[1,2-b]pyridazine? |
| A: InChIKey of 3-Methoxy-2-phenyl-6-(propylthio)imidazo[1,2-b]pyridazine is LNTTZFJCFQJRRN-UHFFFAOYSA-N. |