3-bromo-4-cyclopentyloxybenzoic acid structure
|
Common Name | 3-bromo-4-cyclopentyloxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1131594-17-6 | Molecular Weight | 285.13400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-bromo-4-cyclopentyloxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H13BrO3 |
|---|---|
| Molecular Weight | 285.13400 |
| Exact Mass | 284.00500 |
| PSA | 46.53000 |
| LogP | 3.46870 |
| InChIKey | ATRXLIXURCTCRD-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(OC2CCCC2)c(Br)c1 |
| HS Code | 2918990090 |
|---|
|
~%
3-bromo-4-cyclo... CAS#:1131594-17-6 |
| Literature: ARENA PHARMACEUTICALS, INC. Patent: WO2009/78983 A1, 2009 ; Location in patent: Page/Page column 91 ; WO 2009/078983 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-bromo-4-(cyclopentyloxy)benzoic acid |