methyl 4-[2-hydroxyethyl(methyl)amino]-3-iodobenzoate
Modify Date: 2025-10-06 12:18:16
![methyl 4-[2-hydroxyethyl(methyl)amino]-3-iodobenzoate Structure](https://image.chemsrc.com/caspic/408/1131614-50-0.png)
methyl 4-[2-hydroxyethyl(methyl)amino]-3-iodobenzoate structure
|
Common Name | methyl 4-[2-hydroxyethyl(methyl)amino]-3-iodobenzoate | ||
|---|---|---|---|---|
| CAS Number | 1131614-50-0 | Molecular Weight | 335.13800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14INO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 4-[2-hydroxyethyl(methyl)amino]-3-iodobenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H14INO3 |
|---|---|
| Molecular Weight | 335.13800 |
| Exact Mass | 335.00200 |
| PSA | 49.77000 |
| LogP | 1.50630 |
| InChIKey | LFBCUJQEGUTUHS-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(N(C)CCO)c(I)c1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| methyl 4-((2-hydroxyethyl)(methyl)amino)-3-iodobenzoate |