Methyl 3-iodo-4-(trifluoromethoxy)benzoate
Modify Date: 2025-09-11 21:48:19
Methyl 3-iodo-4-(trifluoromethoxy)benzoate structure
|
Common Name | Methyl 3-iodo-4-(trifluoromethoxy)benzoate | ||
|---|---|---|---|---|
| CAS Number | 1131614-65-7 | Molecular Weight | 346.04200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H6F3IO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl 3-iodo-4-(trifluoromethoxy)benzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H6F3IO3 |
|---|---|
| Molecular Weight | 346.04200 |
| Exact Mass | 345.93100 |
| PSA | 35.53000 |
| LogP | 2.97640 |
| InChIKey | GDNJYOSXXLIZBO-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(OC(F)(F)F)c(I)c1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| methyl 3-iodanyl-4-(trifluoromethyloxy)benzoate |