5-Methyl-4-Phenyl-2-(2-thienyl)-thiazole structure
|
Common Name | 5-Methyl-4-Phenyl-2-(2-thienyl)-thiazole | ||
|---|---|---|---|---|
| CAS Number | 113214-30-5 | Molecular Weight | 257.374 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 412.8±37.0 °C at 760 mmHg | |
| Molecular Formula | C14H11NS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.0±16.9 °C | |
Use of 5-Methyl-4-Phenyl-2-(2-thienyl)-thiazoleWAY-639729 is an active molecule. |
| Name | 5-Methyl-4-phenyl-2-(2-thienyl)thiazole |
|---|---|
| Synonym | More Synonyms |
| Description | WAY-639729 is an active molecule. |
|---|---|
| Related Catalog |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 412.8±37.0 °C at 760 mmHg |
| Molecular Formula | C14H11NS2 |
| Molecular Weight | 257.374 |
| Flash Point | 193.0±16.9 °C |
| Exact Mass | 257.033295 |
| LogP | 5.06 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.640 |
| InChIKey | GJCUAOPBECGQBG-UHFFFAOYSA-N |
| SMILES | Cc1sc(-c2cccs2)nc1-c1ccccc1 |
| Storage condition | -20°C |
| 5-Methyl-4-phenyl-2-(2-thienyl)-1,3-thiazole |
| 5-Methyl-4-Phenyl-2-(2-thienyl)-thiazole |
| MFCD06368612 |
| 5-Methyl-4-phenyl-2-(thiophen-2-yl)thiazole |
| 5-methyl-4-phenyl-2-(thiophen-2-yl)-1,3-thiazole |
| Thiazole, 5-methyl-4-phenyl-2-(2-thienyl)- |