(1-acetamido-2,2,2-trichloroethyl) benzoate structure
|
Common Name | (1-acetamido-2,2,2-trichloroethyl) benzoate | ||
|---|---|---|---|---|
| CAS Number | 113236-24-1 | Molecular Weight | 310.56100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10Cl3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (1-acetamido-2,2,2-trichloroethyl) benzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H10Cl3NO3 |
|---|---|
| Molecular Weight | 310.56100 |
| Exact Mass | 308.97300 |
| PSA | 58.89000 |
| LogP | 3.51610 |
| InChIKey | QJKQYFDQOVFLAP-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(OC(=O)c1ccccc1)C(Cl)(Cl)Cl |
|
~%
(1-acetamido-2,... CAS#:113236-24-1 |
| Literature: Meldrum; Deodhar Journal of the Indian Chemical Society, 1934 , vol. 11, p. 530,531 Chem. Zentralbl., 1935 , vol. 106, # I p. 48 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Acetamide,N-[1-(benzoyloxy)-2,2,2-trichloroethyl] |
| 2-acetylamino-2-benzoyloxy-1,1,1-trichloro-ethane |
| 2-Acetylamino-2-benzoyloxy-1,1,1-trichlor-aethan |