113237-06-2
Modify Date: 2026-09-15 00:03:41
113237-06-2 structure
|
Common Name | N/A | ||
|---|---|---|---|---|
| CAS Number | 113237-06-2 | Molecular Weight | 229.39100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H23NO2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| No information of Name |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H23NO2Si |
|---|---|
| Molecular Weight | 229.39100 |
| Exact Mass | 229.15000 |
| PSA | 29.54000 |
| LogP | 2.88500 |
| InChIKey | GVMNJOMTQUDVRM-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CCOC(=O)N1CCCCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 113237-06-2? |
| A: SMILES notation of 113237-06-2 is C[Si](C)(C)CCOC(=O)N1CCCCC1. |
| Q: What is the LogP of 113237-06-2? |
| A: LogP of 113237-06-2 is 2.88500. |
| Q: What is the molecular weight of 113237-06-2? |
| A: Molecular weight of 113237-06-2 is 229.39100. |
| Q: What is the Chinese name of 113237-06-2? |
| A: Chinese name of 113237-06-2 is 113237-06-2. |
| Q: What is the polar surface area (PSA) of 113237-06-2? |
| A: Polar surface area (PSA) of 113237-06-2 is 29.54000. |
| Q: What is the English name of 113237-06-2? |
| A: The English name of 113237-06-2 is 113237-06-2. |
| Q: What is the molecular formula of 113237-06-2? |
| A: Molecular formula of 113237-06-2 is C11H23NO2Si. |
| Q: What is the InChIKey of 113237-06-2? |
| A: InChIKey of 113237-06-2 is GVMNJOMTQUDVRM-UHFFFAOYSA-N. |
| Q: What is the CAS number of 113237-06-2? |
| A: CAS number of 113237-06-2 is 113237-06-2. |