5h-Pyrazolo[4,3-c]pyridine,5-methyl-3-phenyl
Modify Date: 2025-11-02 14:28:46
![5h-Pyrazolo[4,3-c]pyridine,5-methyl-3-phenyl Structure](https://www.chemsrc.com/extcaspic/202/113277-59-1.png)
5h-Pyrazolo[4,3-c]pyridine,5-methyl-3-phenyl structure
|
Common Name | 5h-Pyrazolo[4,3-c]pyridine,5-methyl-3-phenyl | ||
|---|---|---|---|---|
| CAS Number | 113277-59-1 | Molecular Weight | 209.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5h-Pyrazolo[4,3-c]pyridine,5-methyl-3-phenyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H11N3 |
|---|---|
| Molecular Weight | 209.25 |
| InChIKey | OMSSGOMNIAEEDD-UHFFFAOYSA-N |
| SMILES | Cn1ccc2nnc(-c3ccccc3)c-2c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 5h-Pyrazolo[4,3-c]pyridine,5-methyl-3-phenyl? |
| A: Molecular weight of 5h-Pyrazolo[4,3-c]pyridine,5-methyl-3-phenyl is 209.25. |
| Q: What is the Chinese name of 113277-59-1? |
| A: Chinese name of 113277-59-1 is 113277-59-1. |
| Q: What is the CAS number of 5h-Pyrazolo[4,3-c]pyridine,5-methyl-3-phenyl? |
| A: CAS number of 5h-Pyrazolo[4,3-c]pyridine,5-methyl-3-phenyl is 113277-59-1. |
| Q: What is the SMILES notation of 5h-Pyrazolo[4,3-c]pyridine,5-methyl-3-phenyl? |
| A: SMILES notation of 5h-Pyrazolo[4,3-c]pyridine,5-methyl-3-phenyl is Cn1ccc2nnc(-c3ccccc3)c-2c1. |
| Q: What is the InChIKey of 5h-Pyrazolo[4,3-c]pyridine,5-methyl-3-phenyl? |
| A: InChIKey of 5h-Pyrazolo[4,3-c]pyridine,5-methyl-3-phenyl is OMSSGOMNIAEEDD-UHFFFAOYSA-N. |
| Q: What is the English name of 5h-Pyrazolo[4,3-c]pyridine,5-methyl-3-phenyl? |
| A: The English name of 5h-Pyrazolo[4,3-c]pyridine,5-methyl-3-phenyl is 5h-Pyrazolo[4,3-c]pyridine,5-methyl-3-phenyl. |
| Q: What is the molecular formula of 5h-Pyrazolo[4,3-c]pyridine,5-methyl-3-phenyl? |
| A: Molecular formula of 5h-Pyrazolo[4,3-c]pyridine,5-methyl-3-phenyl is C13H11N3. |