Cyclobutanone,2,2,4,4-tetramethyl-3-(1-oxopropoxy)- structure
|
Common Name | Cyclobutanone,2,2,4,4-tetramethyl-3-(1-oxopropoxy)- | ||
|---|---|---|---|---|
| CAS Number | 1133-07-9 | Molecular Weight | 198.25900 | |
| Density | 1.02g/cm3 | Boiling Point | 240.7ºC at 760 mmHg | |
| Molecular Formula | C11H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 96.7ºC | |
| Name | (2,2,4,4-tetramethyl-3-oxocyclobutyl) propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.02g/cm3 |
|---|---|
| Boiling Point | 240.7ºC at 760 mmHg |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.25900 |
| Flash Point | 96.7ºC |
| Exact Mass | 198.12600 |
| PSA | 43.37000 |
| LogP | 1.94330 |
| Vapour Pressure | 0.0374mmHg at 25°C |
| Index of Refraction | 1.458 |
| InChIKey | MDCDFBMSADAKOT-UHFFFAOYSA-N |
| SMILES | CCC(=O)OC1C(C)(C)C(=O)C1(C)C |
|
~%
Cyclobutanone,2... CAS#:1133-07-9 |
| Literature: Meinwald,J. et al. Journal of Organic Chemistry, 1965 , vol. 30, p. 1038 - 1046 |
|
~%
Cyclobutanone,2... CAS#:1133-07-9 |
| Literature: Rees,A.H.; Whiting,M.G. Journal of Organic Chemistry, 1970 , vol. 35, # 12 p. 4167 - 4169 |
| 3-Propionyloxy-2,2,4,4-tetramethyl-cyclobutanon |
| 2,2,4,4-tetramethyl-3-oxocyclobutyl propanoate |
| 3-Propionoxy-2,2,4,4-tetramethyl-cyclobutanon |
| 1-Propionyloxy-2,2,4,4-tetramethylcyclobutan-3-one |