1-methoxyethyl-dimethyl-trimethylsilylsilane structure
|
Common Name | 1-methoxyethyl-dimethyl-trimethylsilylsilane | ||
|---|---|---|---|---|
| CAS Number | 113380-60-2 | Molecular Weight | 190.43100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H22OSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methoxyethyl-dimethyl-trimethylsilylsilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H22OSi2 |
|---|---|
| Molecular Weight | 190.43100 |
| Exact Mass | 190.12100 |
| PSA | 9.23000 |
| LogP | 3.10540 |
| InChIKey | WLSJJWYSAGQSDS-UHFFFAOYSA-N |
| SMILES | COC(C)[Si](C)(C)[Si](C)(C)C |
|
~%
1-methoxyethyl-... CAS#:113380-60-2 |
| Literature: Bain,S.; Ijadi-Maghsoodi,S.; Barton,T.J. Journal of the American Chemical Society, 1988 , vol. 110, p. 2611 |
|
~%
1-methoxyethyl-... CAS#:113380-60-2 |
| Literature: Bain,S.; Ijadi-Maghsoodi,S.; Barton,T.J. Journal of the American Chemical Society, 1988 , vol. 110, p. 2611 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| (1-methoxyethyl)pentamethyldisilane |
| Disilane,(1-methoxyethyl)pentamethyl |