3-(3,5-dimethylpyrazol-1-yl)-5-phenylthieno[2,3-d][1,2]thiazole 1,1-dioxide structure
|
Common Name | 3-(3,5-dimethylpyrazol-1-yl)-5-phenylthieno[2,3-d][1,2]thiazole 1,1-dioxide | ||
|---|---|---|---|---|
| CAS Number | 113387-73-8 | Molecular Weight | 343.42300 | |
| Density | 1.49g/cm3 | Boiling Point | 624.2ºC at 760 mmHg | |
| Molecular Formula | C16H13N3O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 331.3ºC | |
| Name | 3-(3,5-dimethylpyrazol-1-yl)-5-phenylthieno[2,3-d][1,2]thiazole 1,1-dioxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 624.2ºC at 760 mmHg |
| Molecular Formula | C16H13N3O2S2 |
| Molecular Weight | 343.42300 |
| Flash Point | 331.3ºC |
| Exact Mass | 343.04500 |
| PSA | 100.94000 |
| LogP | 3.74200 |
| Vapour Pressure | 1.68E-15mmHg at 25°C |
| Index of Refraction | 1.748 |
| InChIKey | XDCAPURAJUSKQF-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)n(C2=NS(=O)(=O)c3cc(-c4ccccc4)sc32)n1 |
|
~%
3-(3,5-dimethyl... CAS#:113387-73-8 |
| Literature: Vega, Salvador; Madronero, Ramon; Diaz, J. Antonio; Junquera, Francisco; Alonso, Javier; et al. European Journal of Medicinal Chemistry, 1988 , vol. 23, p. 329 - 334 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Thieno(2,3-d)isothiazole,3-(3,5-dimethyl-1H-pyrazol-1-yl)-5-phenyl-,1,1-dioxide |
| 3-(3,5-Dimethyl-1H-pyrazol-1-yl)-5-phenylthieno(2,3-d)isothiazole 1,1-dioxide |