3-(4-chloro-3,5-dimethylpyrazol-1-yl)-5-phenylthieno[2,3-d][1,2]thiazole 1,1-dioxide structure
|
Common Name | 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-5-phenylthieno[2,3-d][1,2]thiazole 1,1-dioxide | ||
|---|---|---|---|---|
| CAS Number | 113387-74-9 | Molecular Weight | 377.86800 | |
| Density | 1.58g/cm3 | Boiling Point | 646.7ºC at 760 mmHg | |
| Molecular Formula | C16H12ClN3O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 344.9ºC | |
| Name | 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-5-phenylthieno[2,3-d][1,2]thiazole 1,1-dioxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.58g/cm3 |
|---|---|
| Boiling Point | 646.7ºC at 760 mmHg |
| Molecular Formula | C16H12ClN3O2S2 |
| Molecular Weight | 377.86800 |
| Flash Point | 344.9ºC |
| Exact Mass | 377.00600 |
| PSA | 100.94000 |
| LogP | 4.39540 |
| Vapour Pressure | 1.31E-16mmHg at 25°C |
| Index of Refraction | 1.757 |
| InChIKey | CLRISKKTEWJIRN-UHFFFAOYSA-N |
| SMILES | Cc1nn(C2=NS(=O)(=O)c3cc(-c4ccccc4)sc32)c(C)c1Cl |
|
~%
3-(4-chloro-3,5... CAS#:113387-74-9 |
| Literature: European Journal of Medicinal Chemistry, , vol. 23, p. 329 - 334 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Thieno(2,3-d)isothiazole,3-(4-chloro-3,5-dimethyl-1H-pyrazol-1-yl)-5-phenyl-,1,1-dioxide |
| 3-(4-Chloro-3,5-dimethyl-1H-pyrazol-1-yl)-5-phenylthieno(2,3-d)isothiazole 1,1-dioxide |