3-(benzotriazol-1-yl)-5-phenylthieno[2,3-d][1,2]thiazole 1,1-dioxide structure
|
Common Name | 3-(benzotriazol-1-yl)-5-phenylthieno[2,3-d][1,2]thiazole 1,1-dioxide | ||
|---|---|---|---|---|
| CAS Number | 113412-71-8 | Molecular Weight | 366.41700 | |
| Density | 1.64g/cm3 | Boiling Point | 677.5ºC at 760 mmHg | |
| Molecular Formula | C17H10N4O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 363.6ºC | |
| Name | 3-(benzotriazol-1-yl)-5-phenylthieno[2,3-d][1,2]thiazole 1,1-dioxide |
|---|
| Density | 1.64g/cm3 |
|---|---|
| Boiling Point | 677.5ºC at 760 mmHg |
| Molecular Formula | C17H10N4O2S2 |
| Molecular Weight | 366.41700 |
| Flash Point | 363.6ºC |
| Exact Mass | 366.02500 |
| PSA | 113.83000 |
| LogP | 3.67340 |
| Vapour Pressure | 3.24E-18mmHg at 25°C |
| Index of Refraction | 1.838 |
| InChIKey | DHADUOSCVDGLAA-UHFFFAOYSA-N |
| SMILES | O=S1(=O)N=C(n2nnc3ccccc32)c2sc(-c3ccccc3)cc21 |
|
~%
3-(benzotriazol... CAS#:113412-71-8 |
| Literature: European Journal of Medicinal Chemistry, , vol. 23, p. 329 - 334 |