[2-(tributylstannylmethyl)phenyl]methanol structure
|
Common Name | [2-(tributylstannylmethyl)phenyl]methanol | ||
|---|---|---|---|---|
| CAS Number | 113431-27-9 | Molecular Weight | 411.20000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H36OSn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [2-(tributylstannylmethyl)phenyl]methanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H36OSn |
|---|---|
| Molecular Weight | 411.20000 |
| Exact Mass | 412.17900 |
| PSA | 20.23000 |
| LogP | 5.71640 |
| InChIKey | UYVBVZHCEWLCOL-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(CCCC)Cc1ccccc1CO |
|
~69%
[2-(tributylsta... CAS#:113431-27-9 |
| Literature: Sano,H.; Ohtsuka,H.; Migita,T. Journal of the American Chemical Society, 1988 , vol. 110, p. 2014 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| o-(hydroxymethyl)benzyltributylstannane |
| Benzenemethanol,2-[(tributylstannyl)methyl] |