(2-phenyl-1,3-dioxan-5-yl) butanoate structure
|
Common Name | (2-phenyl-1,3-dioxan-5-yl) butanoate | ||
|---|---|---|---|---|
| CAS Number | 113516-75-9 | Molecular Weight | 250.29000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-phenyl-1,3-dioxan-5-yl) butanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H18O4 |
|---|---|
| Molecular Weight | 250.29000 |
| Exact Mass | 250.12100 |
| PSA | 44.76000 |
| LogP | 2.44390 |
| InChIKey | KJZPGIUCDBIMNS-UHFFFAOYSA-N |
| SMILES | CCCC(=O)OC1COC(c2ccccc2)OC1 |
|
~%
(2-phenyl-1,3-d... CAS#:113516-75-9 |
| Literature: Daubert Journal of the American Chemical Society, 1940 , vol. 62, p. 1713 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Butanoic acid,2-phenyl-1,3-dioxan-5-yl ester |
| cis-5-butyryloxy-2-phenyl-[1,3]dioxane |