1,6,13,18,25,30-Hexaoxacyclohexatriacontane-7,12,19,24,31,36-hexone
Modify Date: 2025-09-10 10:21:02
1,6,13,18,25,30-Hexaoxacyclohexatriacontane-7,12,19,24,31,36-hexone structure
|
Common Name | 1,6,13,18,25,30-Hexaoxacyclohexatriacontane-7,12,19,24,31,36-hexone | ||
|---|---|---|---|---|
| CAS Number | 1135871-65-6 | Molecular Weight | 600.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H48O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,6,13,18,25,30-Hexaoxacyclohexatriacontane-7,12,19,24,31,36-hexone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C30H48O12 |
|---|---|
| Molecular Weight | 600.7 |
| InChIKey | SKOQMASJGYLLBF-UHFFFAOYSA-N |
| SMILES | O=C1CCCCC(=O)OCCCCOC(=O)CCCCC(=O)OCCCCOC(=O)CCCCC(=O)OCCCCO1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1,6,13,18,25,30-Hexaoxacyclohexatriacontane-7,12,19,24,31,36-hexone? |
| A: Molecular formula of 1,6,13,18,25,30-Hexaoxacyclohexatriacontane-7,12,19,24,31,36-hexone is C30H48O12. |
| Q: What is the SMILES notation of 1,6,13,18,25,30-Hexaoxacyclohexatriacontane-7,12,19,24,31,36-hexone? |
| A: SMILES notation of 1,6,13,18,25,30-Hexaoxacyclohexatriacontane-7,12,19,24,31,36-hexone is O=C1CCCCC(=O)OCCCCOC(=O)CCCCC(=O)OCCCCOC(=O)CCCCC(=O)OCCCCO1. |
| Q: What is the molecular weight of 1,6,13,18,25,30-Hexaoxacyclohexatriacontane-7,12,19,24,31,36-hexone? |
| A: Molecular weight of 1,6,13,18,25,30-Hexaoxacyclohexatriacontane-7,12,19,24,31,36-hexone is 600.7. |
| Q: What is the InChIKey of 1,6,13,18,25,30-Hexaoxacyclohexatriacontane-7,12,19,24,31,36-hexone? |
| A: InChIKey of 1,6,13,18,25,30-Hexaoxacyclohexatriacontane-7,12,19,24,31,36-hexone is SKOQMASJGYLLBF-UHFFFAOYSA-N. |
| Q: What is the English name of 1,6,13,18,25,30-Hexaoxacyclohexatriacontane-7,12,19,24,31,36-hexone? |
| A: The English name of 1,6,13,18,25,30-Hexaoxacyclohexatriacontane-7,12,19,24,31,36-hexone is 1,6,13,18,25,30-Hexaoxacyclohexatriacontane-7,12,19,24,31,36-hexone. |
| Q: What is the Chinese name of 1135871-65-6? |
| A: Chinese name of 1135871-65-6 is 1135871-65-6. |
| Q: What is the CAS number of 1,6,13,18,25,30-Hexaoxacyclohexatriacontane-7,12,19,24,31,36-hexone? |
| A: CAS number of 1,6,13,18,25,30-Hexaoxacyclohexatriacontane-7,12,19,24,31,36-hexone is 1135871-65-6. |