Propane-2-sulfonic acid (4-methylsulfanyl-phenyl)-amide
Modify Date: 2025-10-31 19:42:02
Propane-2-sulfonic acid (4-methylsulfanyl-phenyl)-amide structure
|
Common Name | Propane-2-sulfonic acid (4-methylsulfanyl-phenyl)-amide | ||
|---|---|---|---|---|
| CAS Number | 1136810-94-0 | Molecular Weight | 245.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H15NO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Propane-2-sulfonic acid (4-methylsulfanyl-phenyl)-amide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H15NO2S2 |
|---|---|
| Molecular Weight | 245.4 |
| InChIKey | BXFUHYRFOLJHJQ-UHFFFAOYSA-N |
| SMILES | CSc1ccc(NS(=O)(=O)C(C)C)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Propane-2-sulfonic acid (4-methylsulfanyl-phenyl)-amide? |
| A: Molecular weight of Propane-2-sulfonic acid (4-methylsulfanyl-phenyl)-amide is 245.4. |
| Q: What is the CAS number of Propane-2-sulfonic acid (4-methylsulfanyl-phenyl)-amide? |
| A: CAS number of Propane-2-sulfonic acid (4-methylsulfanyl-phenyl)-amide is 1136810-94-0. |
| Q: What is the InChIKey of Propane-2-sulfonic acid (4-methylsulfanyl-phenyl)-amide? |
| A: InChIKey of Propane-2-sulfonic acid (4-methylsulfanyl-phenyl)-amide is BXFUHYRFOLJHJQ-UHFFFAOYSA-N. |
| Q: What is the English name of Propane-2-sulfonic acid (4-methylsulfanyl-phenyl)-amide? |
| A: The English name of Propane-2-sulfonic acid (4-methylsulfanyl-phenyl)-amide is Propane-2-sulfonic acid (4-methylsulfanyl-phenyl)-amide. |
| Q: What is the Chinese name of 1136810-94-0? |
| A: Chinese name of 1136810-94-0 is 1136810-94-0. |
| Q: What is the SMILES notation of Propane-2-sulfonic acid (4-methylsulfanyl-phenyl)-amide? |
| A: SMILES notation of Propane-2-sulfonic acid (4-methylsulfanyl-phenyl)-amide is CSc1ccc(NS(=O)(=O)C(C)C)cc1. |
| Q: What is the molecular formula of Propane-2-sulfonic acid (4-methylsulfanyl-phenyl)-amide? |
| A: Molecular formula of Propane-2-sulfonic acid (4-methylsulfanyl-phenyl)-amide is C10H15NO2S2. |