2-Amino-2-(2,4,5-trimethoxyphenyl)acetic acid hydrochloride
Modify Date: 2026-07-14 23:29:25
2-Amino-2-(2,4,5-trimethoxyphenyl)acetic acid hydrochloride structure
|
Common Name | 2-Amino-2-(2,4,5-trimethoxyphenyl)acetic acid hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1136834-73-5 | Molecular Weight | 277.70 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16ClNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Amino-2-(2,4,5-trimethoxyphenyl)acetic acid hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H16ClNO5 |
|---|---|
| Molecular Weight | 277.70 |
| InChIKey | CTYCUFQVONPESM-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c(C(N)C(=O)O)cc1OC.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1136834-73-5? |
| A: Chinese name of 1136834-73-5 is 1136834-73-5. |
| Q: What is the English name of 2-Amino-2-(2,4,5-trimethoxyphenyl)acetic acid hydrochloride? |
| A: The English name of 2-Amino-2-(2,4,5-trimethoxyphenyl)acetic acid hydrochloride is 2-Amino-2-(2,4,5-trimethoxyphenyl)acetic acid hydrochloride. |
| Q: What is the SMILES notation of 2-Amino-2-(2,4,5-trimethoxyphenyl)acetic acid hydrochloride? |
| A: SMILES notation of 2-Amino-2-(2,4,5-trimethoxyphenyl)acetic acid hydrochloride is COc1cc(OC)c(C(N)C(=O)O)cc1OC.Cl. |
| Q: What is the InChIKey of 2-Amino-2-(2,4,5-trimethoxyphenyl)acetic acid hydrochloride? |
| A: InChIKey of 2-Amino-2-(2,4,5-trimethoxyphenyl)acetic acid hydrochloride is CTYCUFQVONPESM-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-Amino-2-(2,4,5-trimethoxyphenyl)acetic acid hydrochloride? |
| A: Molecular formula of 2-Amino-2-(2,4,5-trimethoxyphenyl)acetic acid hydrochloride is C11H16ClNO5. |
| Q: What is the molecular weight of 2-Amino-2-(2,4,5-trimethoxyphenyl)acetic acid hydrochloride? |
| A: Molecular weight of 2-Amino-2-(2,4,5-trimethoxyphenyl)acetic acid hydrochloride is 277.70. |
| Q: What is the CAS number of 2-Amino-2-(2,4,5-trimethoxyphenyl)acetic acid hydrochloride? |
| A: CAS number of 2-Amino-2-(2,4,5-trimethoxyphenyl)acetic acid hydrochloride is 1136834-73-5. |