4-(4-methylphenyl)-3-(trifluoromethyl)-1H-pyrazol-5-amine structure
|
Common Name | 4-(4-methylphenyl)-3-(trifluoromethyl)-1H-pyrazol-5-amine | ||
|---|---|---|---|---|
| CAS Number | 1136835-67-0 | Molecular Weight | 241.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10F3N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-methylphenyl)-3-(trifluoromethyl)-1H-pyrazol-5-amine |
|---|
| Molecular Formula | C11H10F3N3 |
|---|---|
| Molecular Weight | 241.21 |
| InChIKey | LTNZDOQBXPXXRV-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2c(N)n[nH]c2C(F)(F)F)cc1 |
|
Name: High Throughput Screening of small molecules that kill Mycobacterium tuberculosis
Source: 15607
Target: N/A
External Id: Cornell_MTB_2017
|