2,4,6-Trihydroxy-1,3-benzenedicarboxylic acid
Modify Date: 2025-11-07 01:53:58
2,4,6-Trihydroxy-1,3-benzenedicarboxylic acid structure
|
Common Name | 2,4,6-Trihydroxy-1,3-benzenedicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1137-05-9 | Molecular Weight | 214.13 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H6O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4,6-Trihydroxy-1,3-benzenedicarboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H6O7 |
|---|---|
| Molecular Weight | 214.13 |
| InChIKey | RCEALALDBBBQNC-UHFFFAOYSA-N |
| SMILES | O=C(O)c1c(O)cc(O)c(C(=O)O)c1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2,4,6-Trihydroxy-1,3-benzenedicarboxylic acid? |
| A: Molecular weight of 2,4,6-Trihydroxy-1,3-benzenedicarboxylic acid is 214.13. |
| Q: What is the molecular formula of 2,4,6-Trihydroxy-1,3-benzenedicarboxylic acid? |
| A: Molecular formula of 2,4,6-Trihydroxy-1,3-benzenedicarboxylic acid is C8H6O7. |
| Q: What is the CAS number of 2,4,6-Trihydroxy-1,3-benzenedicarboxylic acid? |
| A: CAS number of 2,4,6-Trihydroxy-1,3-benzenedicarboxylic acid is 1137-05-9. |
| Q: What is the SMILES notation of 2,4,6-Trihydroxy-1,3-benzenedicarboxylic acid? |
| A: SMILES notation of 2,4,6-Trihydroxy-1,3-benzenedicarboxylic acid is O=C(O)c1c(O)cc(O)c(C(=O)O)c1O. |
| Q: What is the English name of 2,4,6-Trihydroxy-1,3-benzenedicarboxylic acid? |
| A: The English name of 2,4,6-Trihydroxy-1,3-benzenedicarboxylic acid is 2,4,6-Trihydroxy-1,3-benzenedicarboxylic acid. |
| Q: What is the Chinese name of 1137-05-9? |
| A: Chinese name of 1137-05-9 is 1137-05-9. |
| Q: What is the InChIKey of 2,4,6-Trihydroxy-1,3-benzenedicarboxylic acid? |
| A: InChIKey of 2,4,6-Trihydroxy-1,3-benzenedicarboxylic acid is RCEALALDBBBQNC-UHFFFAOYSA-N. |