ethyl 2-[7-(ethoxycarbonylamino)-4-methyl-2-oxochromen-3-yl]acetate structure
|
Common Name | ethyl 2-[7-(ethoxycarbonylamino)-4-methyl-2-oxochromen-3-yl]acetate | ||
|---|---|---|---|---|
| CAS Number | 113721-84-9 | Molecular Weight | 333.33600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H19NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-[7-(ethoxycarbonylamino)-4-methyl-2-oxochromen-3-yl]acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H19NO6 |
|---|---|
| Molecular Weight | 333.33600 |
| Exact Mass | 333.12100 |
| PSA | 98.33000 |
| LogP | 2.78900 |
| InChIKey | JQRVFKVEEASKLL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1c(C)c2ccc(NC(=O)OCC)cc2oc1=O |
|
~%
ethyl 2-[7-(eth... CAS#:113721-84-9 |
| Literature: Feng, Yangbo; Burgess, Kevin; Pledger, David; Cairns, Nick; Linthicum, D. Scott Bioorganic and Medicinal Chemistry Letters, 1998 , vol. 8, # 7 p. 881 - 884 |
|
~%
ethyl 2-[7-(eth... CAS#:113721-84-9 |
| Literature: Feng, Yangbo; Burgess, Kevin; Pledger, David; Cairns, Nick; Linthicum, D. Scott Bioorganic and Medicinal Chemistry Letters, 1998 , vol. 8, # 7 p. 881 - 884 |
| 7-carboethoxyamido-4-methylcoumarin-3-acetic acid ethyl ester |
| 7-[(Ethoxycarbonyl)amino]-4-methyl-2-oxo-2H-1-benzopyran-3-acetic acid ethyl ester |