3-benzyl-5-[(4-benzyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)disulfanyl]-1,3,4-thiadiazole-2-thione structure
|
Common Name | 3-benzyl-5-[(4-benzyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)disulfanyl]-1,3,4-thiadiazole-2-thione | ||
|---|---|---|---|---|
| CAS Number | 113755-06-9 | Molecular Weight | 478.72100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H14N4S6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-benzyl-5-[(4-benzyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)disulfanyl]-1,3,4-thiadiazole-2-thione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H14N4S6 |
|---|---|
| Molecular Weight | 478.72100 |
| Exact Mass | 477.95400 |
| PSA | 206.90000 |
| LogP | 6.55760 |
| InChIKey | YPQZMFRGRIUBJI-UHFFFAOYSA-N |
| SMILES | S=c1sc(SSc2nn(Cc3ccccc3)c(=S)s2)nn1Cc1ccccc1 |
|
~%
3-benzyl-5-[(4-... CAS#:113755-06-9 |
| Literature: Baker et al. Journal of the Chemical Society, 1951 , p. 289 |
|
~%
3-benzyl-5-[(4-... CAS#:113755-06-9 |
| Literature: Baker et al. Journal of the Chemical Society, 1951 , p. 289 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,3,4-Thiadiazole-2(3H)-thione,5,5'-dithiobis[3-(phenylmethyl) |
| 3,3'-Dibenzyl-3H,3'H-5,5'-disulfandiyl-bis-[1,3,4]thiadiazol-2-thion |
| 3,3'-dibenzyl-3H,3'H-5,5'-disulfanediyl-bis-[1,3,4]thiadiazole-2-thione |