4-amino-3-[(4-methylphenoxy)methyl]-1H-1,2,4-triazole-5-thione structure
|
Common Name | 4-amino-3-[(4-methylphenoxy)methyl]-1H-1,2,4-triazole-5-thione | ||
|---|---|---|---|---|
| CAS Number | 113766-05-5 | Molecular Weight | 236.29300 | |
| Density | 1.4g/cm3 | Boiling Point | 378.2ºC at 760mmHg | |
| Molecular Formula | C10H12N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.5ºC | |
| Name | 4-amino-3-[(4-methylphenoxy)methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 378.2ºC at 760mmHg |
| Molecular Formula | C10H12N4OS |
| Molecular Weight | 236.29300 |
| Flash Point | 182.5ºC |
| Exact Mass | 236.07300 |
| PSA | 104.76000 |
| LogP | 1.74920 |
| Vapour Pressure | 6.41E-06mmHg at 25°C |
| Index of Refraction | 1.688 |
| InChIKey | HJKIXHOOIHRORL-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OCc2n[nH]c(=S)n2N)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-1,2,4-Triazole-5-thione,4-amino-3-((4-methylphenoxy)methyl) |
| 4-Amino-3-((4-methylphenoxy)methyl)-1H-1,2,4-triazole-5-thione |
| 4-Amino-5-[(4-methylphenoxy)methyl]-4H-1,2,4-triazole-3-thiol |
| 3-p-tolyoxymethyl-4-amino-5-mercapto-(4H)-1,2,4-triazole |