2,4-Imidazolidinedione,3-amino-5-ethyl-5-phenyl- structure
|
Common Name | 2,4-Imidazolidinedione,3-amino-5-ethyl-5-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 1139-11-3 | Molecular Weight | 219.24000 | |
| Density | 1.241g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H13N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-amino-5-ethyl-5-phenylimidazolidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.241g/cm3 |
|---|---|
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24000 |
| Exact Mass | 219.10100 |
| PSA | 75.43000 |
| LogP | 1.68440 |
| Index of Refraction | 1.573 |
| InChIKey | XKNVJOJHTAAZCW-UHFFFAOYSA-N |
| SMILES | CCC1(c2ccccc2)NC(=O)N(N)C1=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Aethyl-3-amino-5-phenyl-imidazolidin-2,4-dion |
| 3-amino-5-ethyl-5-methyl-imidazolidine-2,4-dione |
| 5-ethyl-3-amino-5-phenyl-imidazolidine-2,4-dione |
| 5-Aethyl-3-amino-5-methyl-imidazolidin-2,4-dion |
| 3-amino-5-ethyl-5-phenyl-imidazolidine-2,4-dione |
| 3-Amino-5-methyl-5-ethyl-hydantoin |
| 5-Aethyl-5-phenyl-3-amino-hydantoin |
| 5-ethyl-3-amino-5-methyl-imidazolidine-2,4-dione |
| 5-Aethyl-5-methyl-3-amino-hydantoin |