6,6,7-trimethyl-[1,3]dioxolo[4,5-g]chromene structure
|
Common Name | 6,6,7-trimethyl-[1,3]dioxolo[4,5-g]chromene | ||
|---|---|---|---|---|
| CAS Number | 113949-30-7 | Molecular Weight | 218.24800 | |
| Density | 1.159g/cm3 | Boiling Point | 309.1ºC at 760 mmHg | |
| Molecular Formula | C13H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 103.1ºC | |
| Name | 6,6,7-trimethyl-[1,3]dioxolo[4,5-g]chromene |
|---|
| Density | 1.159g/cm3 |
|---|---|
| Boiling Point | 309.1ºC at 760 mmHg |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.24800 |
| Flash Point | 103.1ºC |
| Exact Mass | 218.09400 |
| PSA | 27.69000 |
| LogP | 2.98960 |
| Vapour Pressure | 0.00119mmHg at 25°C |
| Index of Refraction | 1.548 |
| InChIKey | SPGPZJVBCJJVMN-UHFFFAOYSA-N |
| SMILES | CC1=Cc2cc3c(cc2OC1(C)C)OCO3 |
|
~55%
6,6,7-trimethyl... CAS#:113949-30-7 |
| Literature: Pandey, G.; Krishna, A. Journal of Organic Chemistry, 1988 , vol. 53, # 10 p. 2364 - 2365 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |