tributylstannyl N-benzyl-N-methylcarbamodithioate structure
|
Common Name | tributylstannyl N-benzyl-N-methylcarbamodithioate | ||
|---|---|---|---|---|
| CAS Number | 114026-53-8 | Molecular Weight | 486.35600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H37NS2Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tributylstannyl N-benzyl-N-methylcarbamodithioate |
|---|
| Molecular Formula | C21H37NS2Sn |
|---|---|
| Molecular Weight | 486.35600 |
| Exact Mass | 487.13900 |
| PSA | 35.33000 |
| LogP | 6.43120 |
| InChIKey | PUSLZJORIAHUTK-UHFFFAOYSA-M |
| SMILES | CCCC[Sn](CCCC)(CCCC)SC(=S)N(C)Cc1ccccc1 |
|
~80%
tributylstannyl... CAS#:114026-53-8 |
| Literature: Sharma, C. P.; Kumar, N.; Sharma, R. K.; Garg, B. S. Journal of the Indian Chemical Society, 1986 , vol. 63, p. 711 - 713 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |