4-azidopyrene structure
|
Common Name | 4-azidopyrene | ||
|---|---|---|---|---|
| CAS Number | 114049-41-1 | Molecular Weight | 243.26300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H9N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-azidopyrene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H9N3 |
|---|---|
| Molecular Weight | 243.26300 |
| Exact Mass | 243.08000 |
| PSA | 49.75000 |
| LogP | 4.97856 |
| InChIKey | NTOVYDOITUHQSO-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=Nc1cc2cccc3ccc4cccc1c4c32 |
|
~%
4-azidopyrene CAS#:114049-41-1 |
| Literature: Kashiwagi,H. et al. Bulletin of the Chemical Society of Japan, 1973 , vol. 46, p. 417 - 422 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Pyrene,4-azido |
| 1-Azidopyren |