trimethyl(1,3,3,5-tetrachloropentyl)silane structure
|
Common Name | trimethyl(1,3,3,5-tetrachloropentyl)silane | ||
|---|---|---|---|---|
| CAS Number | 114066-68-1 | Molecular Weight | 282.11000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H16Cl4Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl(1,3,3,5-tetrachloropentyl)silane |
|---|
| Molecular Formula | C8H16Cl4Si |
|---|---|
| Molecular Weight | 282.11000 |
| Exact Mass | 279.97800 |
| LogP | 5.08400 |
| InChIKey | CYCWFPRRNHTRAM-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C(Cl)CC(Cl)(Cl)CCCl |
|
~89%
Detail
|
| Literature: Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), , vol. 36, # 5 p. 1087 - 1089 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, , vol. 36, # 5 p. 1174 - 1177 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |