1,4-bis(1-chloro-2-methylpropan-2-yl)-2-nitrobenzene structure
|
Common Name | 1,4-bis(1-chloro-2-methylpropan-2-yl)-2-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 114093-01-5 | Molecular Weight | 304.21200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,4-bis(1-chloro-2-methylpropan-2-yl)-2-nitrobenzene |
|---|
| Molecular Formula | C14H19Cl2NO2 |
|---|---|
| Molecular Weight | 304.21200 |
| Exact Mass | 303.07900 |
| PSA | 45.82000 |
| LogP | 5.15080 |
| InChIKey | RZTNOEWKIYWXBM-UHFFFAOYSA-N |
| SMILES | CC(C)(CCl)c1ccc(C(C)(C)CCl)c([N+](=O)[O-])c1 |
|
~41%
1,4-bis(1-chlor... CAS#:114093-01-5 |
| Literature: Padmanabhan, Kaillathe; Venkatesan, Kailasam; Schmidt, Rolf; Doepp, Dietrich Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1987 , p. 1153 - 1158 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |