[1S-(1α,2β,5α)]-5-Methyl-2-(1-Methylethyl)cyclohexyl β-D-Glucopyranosiduronic Acid structure
|
Common Name | [1S-(1α,2β,5α)]-5-Methyl-2-(1-Methylethyl)cyclohexyl β-D-Glucopyranosiduronic Acid | ||
|---|---|---|---|---|
| CAS Number | 114127-73-0 | Molecular Weight | 332.38900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H28O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyoxane-2-carboxylic acid |
|---|
| Molecular Formula | C16H28O7 |
|---|---|
| Molecular Weight | 332.38900 |
| Exact Mass | 332.18400 |
| PSA | 116.45000 |
| LogP | 0.35600 |
| InChIKey | CLJGMBYGTHRUNF-YJQUKTSOSA-N |
| SMILES | CC1CCC(C(C)C)C(OC2OC(C(=O)O)C(O)C(O)C2O)C1 |
|
~%
[1S-(1α,2β,5α)]... CAS#:114127-73-0 |
| Literature: Sasaki, Yasuhiro; Morita, Toshinobu; Kuramoto, Takashi; Mizutani, Kenji; Ikeda, Ryuko; Tanaka, Osamu Agricultural and Biological Chemistry, 1988 , vol. 52, # 1 p. 207 - 210 |
|
~%
[1S-(1α,2β,5α)]... CAS#:114127-73-0 |
| Literature: Sasaki, Yasuhiro; Morita, Toshinobu; Kuramoto, Takashi; Mizutani, Kenji; Ikeda, Ryuko; Tanaka, Osamu Agricultural and Biological Chemistry, 1988 , vol. 52, # 1 p. 207 - 210 |