4,6-Dioxo-6-phenylhexanoic acid structure
|
Common Name | 4,6-Dioxo-6-phenylhexanoic acid | ||
|---|---|---|---|---|
| CAS Number | 114150-57-1 | Molecular Weight | 220.22100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,6-Dioxo-6-phenylhexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H12O4 |
|---|---|
| Molecular Weight | 220.22100 |
| Exact Mass | 220.07400 |
| PSA | 71.44000 |
| LogP | 1.69330 |
| InChIKey | RYHMWKGXNUBZPO-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(=O)CC(=O)c1ccccc1 |
| HS Code | 2918300090 |
|---|
|
~%
4,6-Dioxo-6-phe... CAS#:114150-57-1 |
| Literature: Journal of Organic Chemistry, , vol. 55, # 10 p. 3424 - 3426 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4,6-dioxo-6-phenyl-hexanoic acid |
| 6-phenyl-4,6-dioxohexanoic acid |
| dioxophenylhexanoicacid |