N-Hydroxy Tipranavir structure
|
Common Name | N-Hydroxy Tipranavir | ||
|---|---|---|---|---|
| CAS Number | 1141510-06-6 | Molecular Weight | 618.66400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H33F3N2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-Hydroxy Tipranavir |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C31H33F3N2O6S |
|---|---|
| Molecular Weight | 618.66400 |
| Exact Mass | 618.20100 |
| PSA | 125.41000 |
| LogP | 8.19000 |
| InChIKey | YEVFABAGWJZFRK-FYBSXPHGSA-N |
| SMILES | CCCC1(CCc2ccccc2)CC(O)=C(C(CC)c2cccc(N(O)S(=O)(=O)c3ccc(C(F)(F)F)cn3)c2)C(=O)O1 |
|
~34%
N-Hydroxy Tipranavir CAS#:1141510-06-6 |
| Literature: Latli, Bachir; Hrapchak, Matt; Easter, John A.; Stolle, Wayne T.; Grozinger, Karl; Krishnamurthy, Dhileepkumar; Senanayake, Chris H. Journal of Labelled Compounds and Radiopharmaceuticals, 2008 , vol. 51, # 8 p. 314 - 320 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-hydroxy-N-[3-[(1R)-1-[(2R)-4-hydroxy-6-oxo-2-(2-phenylethyl)-2-propyl-3H-pyran-5-yl]propyl]phenyl]-5-(trifluoromethyl)pyridine-2-sulfonamide |