(4-bromophenyl)-[2-[(4-bromophenyl)diazenyl]cyclohexen-1-yl]diazene structure
|
Common Name | (4-bromophenyl)-[2-[(4-bromophenyl)diazenyl]cyclohexen-1-yl]diazene | ||
|---|---|---|---|---|
| CAS Number | 114263-23-9 | Molecular Weight | 448.15400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H16Br2N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-bromophenyl)-[2-[(4-bromophenyl)diazenyl]cyclohexen-1-yl]diazene |
|---|
| Molecular Formula | C18H16Br2N4 |
|---|---|
| Molecular Weight | 448.15400 |
| Exact Mass | 445.97400 |
| PSA | 49.44000 |
| LogP | 7.86480 |
| InChIKey | XRRQCEDUIQDVRC-UHFFFAOYSA-N |
| SMILES | Brc1ccc(N=NC2=C(N=Nc3ccc(Br)cc3)CCCC2)cc1 |
|
~71%
(4-bromophenyl)... CAS#:114263-23-9 |
| Literature: Butler, Richard N.; Gillan, Ann M.; James, John P.; Evans, Ann M. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1989 , p. 159 - 163 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |