6-chloro-N-phenyl-7H-purin-2-amine structure
|
Common Name | 6-chloro-N-phenyl-7H-purin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 114300-74-2 | Molecular Weight | 245.66800 | |
| Density | 1.539g/cm3 | Boiling Point | 566.8ºC at 760 mmHg | |
| Molecular Formula | C11H8ClN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 296.6ºC | |
| Name | 6-chloro-N-phenyl-7H-purin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.539g/cm3 |
|---|---|
| Boiling Point | 566.8ºC at 760 mmHg |
| Molecular Formula | C11H8ClN5 |
| Molecular Weight | 245.66800 |
| Flash Point | 296.6ºC |
| Exact Mass | 245.04700 |
| PSA | 69.72000 |
| LogP | 2.17180 |
| Vapour Pressure | 7.24E-13mmHg at 25°C |
| Index of Refraction | 1.782 |
| InChIKey | XIJHMCHYHSKERV-UHFFFAOYSA-N |
| SMILES | Clc1nc(Nc2ccccc2)nc2nc[nH]c12 |
|
~71%
6-chloro-N-phen... CAS#:114300-74-2 |
| Literature: Focher; Hildebrand; Freese; Ciarrocchi; Noonan; Sangalli; Brown; Spadari; Wright Journal of medicinal chemistry, 1988 , vol. 31, # 8 p. 1496 - 1500 |
|
~%
6-chloro-N-phen... CAS#:114300-74-2 |
| Literature: Focher; Hildebrand; Freese; Ciarrocchi; Noonan; Sangalli; Brown; Spadari; Wright Journal of medicinal chemistry, 1988 , vol. 31, # 8 p. 1496 - 1500 |
|
~%
6-chloro-N-phen... CAS#:114300-74-2 |
| Literature: Focher; Hildebrand; Freese; Ciarrocchi; Noonan; Sangalli; Brown; Spadari; Wright Journal of medicinal chemistry, 1988 , vol. 31, # 8 p. 1496 - 1500 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 9H-Purin-2-amine,6-chloro-N-phenyl |
| 2-phenylamino-6-chloropurine |
| 2-anilino-6-chloropurine |