Bicyclo[2.2.2]octane-1,4-diylbis(diphenylphosphine oxide)
Modify Date: 2026-09-28 23:57:45
![Bicyclo[2.2.2]octane-1,4-diylbis(diphenylphosphine oxide) Structure](https://www.chemsrc.com/extcaspic/360/114378-29-9.png)
Bicyclo[2.2.2]octane-1,4-diylbis(diphenylphosphine oxide) structure
|
Common Name | Bicyclo[2.2.2]octane-1,4-diylbis(diphenylphosphine oxide) | ||
|---|---|---|---|---|
| CAS Number | 114378-29-9 | Molecular Weight | 510.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H32O2P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Bicyclo[2.2.2]octane-1,4-diylbis(diphenylphosphine oxide) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C32H32O2P2 |
|---|---|
| Molecular Weight | 510.5 |
| InChIKey | STRLELIKQUPKQI-UHFFFAOYSA-N |
| SMILES | O=P(c1ccccc1)(c1ccccc1)C12CCC(P(=O)(c3ccccc3)c3ccccc3)(CC1)CC2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Bicyclo[2.2.2]octane-1,4-diylbis(diphenylphosphine oxide)? |
| A: Molecular formula of Bicyclo[2.2.2]octane-1,4-diylbis(diphenylphosphine oxide) is C32H32O2P2. |
| Q: What is the molecular weight of Bicyclo[2.2.2]octane-1,4-diylbis(diphenylphosphine oxide)? |
| A: Molecular weight of Bicyclo[2.2.2]octane-1,4-diylbis(diphenylphosphine oxide) is 510.5. |
| Q: What is the CAS number of Bicyclo[2.2.2]octane-1,4-diylbis(diphenylphosphine oxide)? |
| A: CAS number of Bicyclo[2.2.2]octane-1,4-diylbis(diphenylphosphine oxide) is 114378-29-9. |
| Q: What is the Chinese name of 114378-29-9? |
| A: Chinese name of 114378-29-9 is 114378-29-9. |
| Q: What is the InChIKey of Bicyclo[2.2.2]octane-1,4-diylbis(diphenylphosphine oxide)? |
| A: InChIKey of Bicyclo[2.2.2]octane-1,4-diylbis(diphenylphosphine oxide) is STRLELIKQUPKQI-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Bicyclo[2.2.2]octane-1,4-diylbis(diphenylphosphine oxide)? |
| A: SMILES notation of Bicyclo[2.2.2]octane-1,4-diylbis(diphenylphosphine oxide) is O=P(c1ccccc1)(c1ccccc1)C12CCC(P(=O)(c3ccccc3)c3ccccc3)(CC1)CC2. |
| Q: What is the English name of Bicyclo[2.2.2]octane-1,4-diylbis(diphenylphosphine oxide)? |
| A: The English name of Bicyclo[2.2.2]octane-1,4-diylbis(diphenylphosphine oxide) is Bicyclo[2.2.2]octane-1,4-diylbis(diphenylphosphine oxide). |