1,4-bis(4-methoxyphenyl)-2,3-dioxabicyclo[2.2.2]octane structure
|
Common Name | 1,4-bis(4-methoxyphenyl)-2,3-dioxabicyclo[2.2.2]octane | ||
|---|---|---|---|---|
| CAS Number | 114396-01-9 | Molecular Weight | 326.38600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,4-bis(4-methoxyphenyl)-2,3-dioxabicyclo[2.2.2]octane |
|---|
| Molecular Formula | C20H22O4 |
|---|---|
| Molecular Weight | 326.38600 |
| Exact Mass | 326.15200 |
| PSA | 36.92000 |
| LogP | 4.33040 |
| InChIKey | HCXCIOGPIUHGLV-UHFFFAOYSA-N |
| SMILES | COc1ccc(C23CCC(c4ccc(OC)cc4)(CC2)OO3)cc1 |
|
~70%
1,4-bis(4-metho... CAS#:114396-01-9 |
| Literature: Miyashi, Tsutomu; Konno, Akinori; Takahashi, Yasutake Journal of the American Chemical Society, 1988 , vol. 110, p. 3676 - 3677 |