Z-2-Me-D-Ser-OH
Z-2-Me-D-Ser-OH structure
|
Common Name | Z-2-Me-D-Ser-OH | ||
|---|---|---|---|---|
| CAS Number | 114396-70-2 | Molecular Weight | 253.251 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 483.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C12H15NO5 | Melting Point | 123-126 °C | |
| MSDS | N/A | Flash Point | 246.3±28.7 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (S)-N-Cbz-α-MeSer(OH)-OH |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 483.7±45.0 °C at 760 mmHg |
| Melting Point | 123-126 °C |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.251 |
| Flash Point | 246.3±28.7 °C |
| Exact Mass | 253.095016 |
| PSA | 95.86000 |
| LogP | 1.18 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | QPGOJGJGAWHTFS-LBPRGKRZSA-N |
| SMILES | CC(CO)(NC(=O)OCc1ccccc1)C(=O)O |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Z-α-MeSer(OH)-OH |
| N-carbobenzoxy-DL-α-methylserine |
| (S)-2-(benzyloxycarbonylamino)-3-hydroxy-2-methylpropanoic acid |
| N-[(Benzyloxy)carbonyl]-2-methyl-L-serine |
| Z-2-Me-D-Ser-OH |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (S)-N-Cbz-α-MeSer(OH)-OH? |
| A: CAS number of (S)-N-Cbz-α-MeSer(OH)-OH is 114396-70-2. |
| Q: What is the LogP of (S)-N-Cbz-α-MeSer(OH)-OH? |
| A: LogP of (S)-N-Cbz-α-MeSer(OH)-OH is 1.18. |
| Q: What is the SMILES notation of (S)-N-Cbz-α-MeSer(OH)-OH? |
| A: SMILES notation of (S)-N-Cbz-α-MeSer(OH)-OH is CC(CO)(NC(=O)OCc1ccccc1)C(=O)O. |
| Q: What is the molecular weight of (S)-N-Cbz-α-MeSer(OH)-OH? |
| A: Molecular weight of (S)-N-Cbz-α-MeSer(OH)-OH is 253.251. |
| Q: What is the boiling point of (S)-N-Cbz-α-MeSer(OH)-OH? |
| A: Boiling point of (S)-N-Cbz-α-MeSer(OH)-OH is 483.7±45.0 °C at 760 mmHg. |
| Q: What is the melting point of (S)-N-Cbz-α-MeSer(OH)-OH? |
| A: Melting point of (S)-N-Cbz-α-MeSer(OH)-OH is 123-126 °C. |
| Q: What is the polar surface area (PSA) of (S)-N-Cbz-α-MeSer(OH)-OH? |
| A: Polar surface area (PSA) of (S)-N-Cbz-α-MeSer(OH)-OH is 95.86000. |
| Q: What is the InChIKey of (S)-N-Cbz-α-MeSer(OH)-OH? |
| A: InChIKey of (S)-N-Cbz-α-MeSer(OH)-OH is QPGOJGJGAWHTFS-LBPRGKRZSA-N. |
| Q: What English synonyms does (S)-N-Cbz-α-MeSer(OH)-OH have? |
| A: English synonyms of (S)-N-Cbz-α-MeSer(OH)-OH: Z-α-MeSer(OH)-OH, N-carbobenzoxy-DL-α-methylserine, (S)-2-(benzyloxycarbonylamino)-3-hydroxy-2-methylpropanoic acid, N-[(Benzyloxy)carbonyl]-2-methyl-L-serine, Z-2-Me-D-Ser-OH. |
| Q: What is the molecular formula of (S)-N-Cbz-α-MeSer(OH)-OH? |
| A: Molecular formula of (S)-N-Cbz-α-MeSer(OH)-OH is C12H15NO5. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |