1-(4-fluorophenyl)-4-methylpentane-1,3-dione structure
|
Common Name | 1-(4-fluorophenyl)-4-methylpentane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 114433-94-2 | Molecular Weight | 208.22900 | |
| Density | 1.103 g/cm3 | Boiling Point | 300.4ºC at 760 mmHg | |
| Molecular Formula | C12H13FO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-fluorophenyl)-4-methylpentane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.103 g/cm3 |
|---|---|
| Boiling Point | 300.4ºC at 760 mmHg |
| Molecular Formula | C12H13FO2 |
| Molecular Weight | 208.22900 |
| Exact Mass | 208.09000 |
| PSA | 34.14000 |
| LogP | 2.62360 |
| Vapour Pressure | 0.00112mmHg at 25°C |
| Index of Refraction | 1.492 |
| InChIKey | LAOUURGVXFCRDD-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)CC(=O)c1ccc(F)cc1 |
|
~50%
1-(4-fluorophen... CAS#:114433-94-2 |
| Literature: Sliskovic; Roth; Wilson; Hoefle; Newton Journal of Medicinal Chemistry, 1990 , vol. 33, # 1 p. 31 - 38 |
| Precursor 2 | |
|---|---|
| DownStream 8 | |
| 1-(4-fluorophenyl)-4-methyl-1,3-pentanedione |
| 1-(4-fluorophenyl)-4-methyl-l,3-pentanedione |
| 1,3-Pentanedione,1-(4-fluorophenyl)-4-methyl |