1-(1-methylpyridin-1-ium-3-yl)-2-phenylethanone,bromide structure
|
Common Name | 1-(1-methylpyridin-1-ium-3-yl)-2-phenylethanone,bromide | ||
|---|---|---|---|---|
| CAS Number | 114443-44-6 | Molecular Weight | 292.17100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(1-methylpyridin-1-ium-3-yl)-2-phenylethanone,bromide |
|---|
| Molecular Formula | C14H14BrNO |
|---|---|
| Molecular Weight | 292.17100 |
| Exact Mass | 291.02600 |
| PSA | 20.95000 |
| InChIKey | HUMOFFAUVMZQFO-UHFFFAOYSA-M |
| SMILES | C[n+]1cccc(C(=O)Cc2ccccc2)c1.[Br-] |
|
~%
1-(1-methylpyri... CAS#:114443-44-6 |
| Literature: Bunting, John W.; Stefanides, Dimitrios Journal of the American Chemical Society, 1988 , vol. 110, # 12 p. 4008 - 4017 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |