6-(3-bromophenyl)-2-phenyl-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one
Modify Date: 2025-11-02 22:38:23
![6-(3-bromophenyl)-2-phenyl-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one Structure](https://www.chemsrc.com/extcaspic/129/1144446-64-9.png)
6-(3-bromophenyl)-2-phenyl-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one structure
|
Common Name | 6-(3-bromophenyl)-2-phenyl-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one | ||
|---|---|---|---|---|
| CAS Number | 1144446-64-9 | Molecular Weight | 372.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H18BrN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-(3-bromophenyl)-2-phenyl-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H18BrN3O |
|---|---|
| Molecular Weight | 372.3 |
| InChIKey | PLKMZNZHPAYGBB-UHFFFAOYSA-N |
| SMILES | O=C1C2CCC(c3cccc(Br)c3)NC2NN1c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 6-(3-bromophenyl)-2-phenyl-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one? |
| A: SMILES notation of 6-(3-bromophenyl)-2-phenyl-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one is O=C1C2CCC(c3cccc(Br)c3)NC2NN1c1ccccc1. |
| Q: What is the Chinese name of 1144446-64-9? |
| A: Chinese name of 1144446-64-9 is 1144446-64-9. |
| Q: What is the CAS number of 6-(3-bromophenyl)-2-phenyl-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one? |
| A: CAS number of 6-(3-bromophenyl)-2-phenyl-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one is 1144446-64-9. |
| Q: What is the molecular formula of 6-(3-bromophenyl)-2-phenyl-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one? |
| A: Molecular formula of 6-(3-bromophenyl)-2-phenyl-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one is C18H18BrN3O. |
| Q: What is the English name of 6-(3-bromophenyl)-2-phenyl-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one? |
| A: The English name of 6-(3-bromophenyl)-2-phenyl-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one is 6-(3-bromophenyl)-2-phenyl-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one. |
| Q: What is the molecular weight of 6-(3-bromophenyl)-2-phenyl-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one? |
| A: Molecular weight of 6-(3-bromophenyl)-2-phenyl-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one is 372.3. |
| Q: What is the InChIKey of 6-(3-bromophenyl)-2-phenyl-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one? |
| A: InChIKey of 6-(3-bromophenyl)-2-phenyl-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one is PLKMZNZHPAYGBB-UHFFFAOYSA-N. |